C11H18F3NO2 — CID 77101660
2-ethyl-4-[propyl(2,2,2-trifluoroethyl)amino]but-2-enoic acid (PubChem CID 77101660) has the molecular formula C11H18F3NO2 and a molecular weight of 253.26 g/mol. Its IUPAC name is 2-ethyl-4-[propyl(2,2,2-trifluoroethyl)amino]but-2-enoic acid.
| Compound Name | 2-ethyl-4-[propyl(2,2,2-trifluoroethyl)amino]but-2-enoic acid |
|---|---|
| PubChem CID | 77101660 |
| Molecular Formula | C11H18F3NO2 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 2-ethyl-4-[propyl(2,2,2-trifluoroethyl)amino]but-2-enoic acid |
| SMILES | CCCN(CC=C(CC)C(=O)O)CC(F)(F)F |
| InChI | InChI=1S/C11H18F3NO2/c1-3-6-15(8-11(12,13)14)7-5-9(4-2)10(16)17/h5H,3-4,6-8H2,1-2H3,(H,16,17) |
| InChIKey | WDUKXMKAIPRUGK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|