C12H20F3NO3 — CID 112752243
methyl 2,2-dimethyl-3-oxo-4-[propyl(2,2,2-trifluoroethyl)amino]butanoate (PubChem CID 112752243) has the molecular formula C12H20F3NO3 and a molecular weight of 283.29 g/mol. Its IUPAC name is methyl 2,2-dimethyl-3-oxo-4-[propyl(2,2,2-trifluoroethyl)amino]butanoate.
| Compound Name | methyl 2,2-dimethyl-3-oxo-4-[propyl(2,2,2-trifluoroethyl)amino]butanoate |
|---|---|
| PubChem CID | 112752243 |
| Molecular Formula | C12H20F3NO3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | methyl 2,2-dimethyl-3-oxo-4-[propyl(2,2,2-trifluoroethyl)amino]butanoate |
| SMILES | CCCN(CC(=O)C(C)(C)C(=O)OC)CC(F)(F)F |
| InChI | InChI=1S/C12H20F3NO3/c1-5-6-16(8-12(13,14)15)7-9(17)11(2,3)10(18)19-4/h5-8H2,1-4H3 |
| InChIKey | AQJPNJNUEMQMLZ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|