C14H29NO2 — CID 159831109
tert-butyl 2-[2,2-dimethylpropyl(propyl)amino]acetate (PubChem CID 159831109) has the molecular formula C14H29NO2 and a molecular weight of 243.39 g/mol. Its IUPAC name is tert-butyl 2-[2,2-dimethylpropyl(propyl)amino]acetate.
| Compound Name | tert-butyl 2-[2,2-dimethylpropyl(propyl)amino]acetate |
|---|---|
| PubChem CID | 159831109 |
| Molecular Formula | C14H29NO2 |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.22 |
| IUPAC Name | tert-butyl 2-[2,2-dimethylpropyl(propyl)amino]acetate |
| SMILES | CCCN(CC(=O)OC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C14H29NO2/c1-8-9-15(11-13(2,3)4)10-12(16)17-14(5,6)7/h8-11H2,1-7H3 |
| InChIKey | XPSNCNASZAFXAI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |