C16H29NO6 — CID 71382387
4-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]butanoic acid (PubChem CID 71382387) has the molecular formula C16H29NO6 and a molecular weight of 331.41 g/mol. Its IUPAC name is 4-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]butanoic acid.
| Compound Name | 4-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]butanoic acid |
|---|---|
| PubChem CID | 71382387 |
| Molecular Formula | C16H29NO6 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | 4-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]butanoic acid |
| SMILES | CC(C)(C)OC(=O)CN(CCCC(=O)O)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H29NO6/c1-15(2,3)22-13(20)10-17(9-7-8-12(18)19)11-14(21)23-16(4,5)6/h7-11H2,1-6H3,(H,18,19) |
| InChIKey | MOTAGPUVNXCPKH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |