C12H26N2O3 — CID 113366624
tert-butyl 2-[3-aminopropyl(2-methoxyethyl)amino]acetate (PubChem CID 113366624) has the molecular formula C12H26N2O3 and a molecular weight of 246.35 g/mol. Its IUPAC name is tert-butyl 2-[3-aminopropyl(2-methoxyethyl)amino]acetate.
| Compound Name | tert-butyl 2-[3-aminopropyl(2-methoxyethyl)amino]acetate |
|---|---|
| PubChem CID | 113366624 |
| Molecular Formula | C12H26N2O3 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | tert-butyl 2-[3-aminopropyl(2-methoxyethyl)amino]acetate |
| SMILES | COCCN(CCCN)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H26N2O3/c1-12(2,3)17-11(15)10-14(7-5-6-13)8-9-16-4/h5-10,13H2,1-4H3 |
| InChIKey | KNWQSDQMAKKVKA-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |