C35H66N2O2 — CID 142498872
tert-butyl 2-[2-[bis[(Z)-non-3-enyl]amino]ethyl-[(Z)-non-3-enyl]amino]acetate (PubChem CID 142498872) has the molecular formula C35H66N2O2 and a molecular weight of 546.93 g/mol. Its IUPAC name is tert-butyl 2-[2-[bis[(Z)-non-3-enyl]amino]ethyl-[(Z)-non-3-enyl]amino]acetate.
| Compound Name | tert-butyl 2-[2-[bis[(Z)-non-3-enyl]amino]ethyl-[(Z)-non-3-enyl]amino]acetate |
|---|---|
| PubChem CID | 142498872 |
| Molecular Formula | C35H66N2O2 |
| Molecular Weight | 546.93 g/mol |
| Exact Mass | 546.51 |
| IUPAC Name | tert-butyl 2-[2-[bis[(Z)-non-3-enyl]amino]ethyl-[(Z)-non-3-enyl]amino]acetate |
| SMILES | CCCCC/C=C\CCN(CC/C=C\CCCCC)CCN(CC/C=C\CCCCC)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H66N2O2/c1-7-10-13-16-19-22-25-28-36(29-26-23-20-17-14-11-8-2)31-32-37(33-34(38)39-35(4,5)6)30-27-24-21-18-15-12-9-3/h19-24H,7-18,25-33H2,1-6H3/b22-19-,23-20-,24-21- |
| InChIKey | MDYPOHWPVCZVLK-BUTYCLJRSA-N |
| XLogP | 9.51 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.93 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|