C29H60N2O2 — CID 176669865
tert-butyl N-[2-(diethylamino)ethyl]-N-methylcarbamate;(Z)-heptadec-8-ene (PubChem CID 176669865) has the molecular formula C29H60N2O2 and a molecular weight of 468.81 g/mol. Its IUPAC name is tert-butyl N-[2-(diethylamino)ethyl]-N-methylcarbamate;(Z)-heptadec-8-ene.
| Compound Name | tert-butyl N-[2-(diethylamino)ethyl]-N-methylcarbamate;(Z)-heptadec-8-ene |
|---|---|
| PubChem CID | 176669865 |
| Molecular Formula | C29H60N2O2 |
| Molecular Weight | 468.81 g/mol |
| Exact Mass | 468.47 |
| IUPAC Name | tert-butyl N-[2-(diethylamino)ethyl]-N-methylcarbamate;(Z)-heptadec-8-ene |
| SMILES | CCCCCCC/C=C\CCCCCCCC.CCN(CC)CCN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H34.C12H26N2O2/c1-3-5-7-9-11-13-15-17-16-14-12-10-8-6-4-2;1-7-14(8-2)10-9-13(6)11(15)16-12(3,4)5/h15,17H,3-14,16H2,1-2H3;7-10H2,1-6H3/b17-15-; |
| InChIKey | AJJRRBZBVUGINM-NYDCQJDFSA-N |
| XLogP | 8.85 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.81 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|