C22H45NO2 — CID 176669874
tert-butyl N-methylcarbamate;(Z)-hexadec-8-ene (PubChem CID 176669874) has the molecular formula C22H45NO2 and a molecular weight of 355.61 g/mol. Its IUPAC name is tert-butyl N-methylcarbamate;(Z)-hexadec-8-ene.
| Compound Name | tert-butyl N-methylcarbamate;(Z)-hexadec-8-ene |
|---|---|
| PubChem CID | 176669874 |
| Molecular Formula | C22H45NO2 |
| Molecular Weight | 355.61 g/mol |
| Exact Mass | 355.35 |
| IUPAC Name | tert-butyl N-methylcarbamate;(Z)-hexadec-8-ene |
| SMILES | CCCCCCC/C=C\CCCCCCC.CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H32.C6H13NO2/c1-3-5-7-9-11-13-15-16-14-12-10-8-6-4-2;1-6(2,3)9-5(8)7-4/h15-16H,3-14H2,1-2H3;1-4H3,(H,7,8)/b16-15-; |
| InChIKey | ICPKBCKKJOCFKF-YFKNTREVSA-N |
| XLogP | 7.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.61 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|