C16H29NO2 — CID 135045437
tert-butyl N-[(E)-2-methylidenedec-3-enyl]carbamate (PubChem CID 135045437) has the molecular formula C16H29NO2 and a molecular weight of 267.41 g/mol. Its IUPAC name is tert-butyl N-[(E)-2-methylidenedec-3-enyl]carbamate.
| Compound Name | tert-butyl N-[(E)-2-methylidenedec-3-enyl]carbamate |
|---|---|
| PubChem CID | 135045437 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | tert-butyl N-[(E)-2-methylidenedec-3-enyl]carbamate |
| SMILES | C=C(/C=C/CCCCCC)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H29NO2/c1-6-7-8-9-10-11-12-14(2)13-17-15(18)19-16(3,4)5/h11-12H,2,6-10,13H2,1,3-5H3,(H,17,18)/b12-11+ |
| InChIKey | IGSYLDCTHXSAFJ-VAWYXSNFSA-N |
| XLogP | 4.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|