C15H25NO4S — CID 166689590
tert-butyl N-[(3Z,5E)-5-ethylsulfonyl-2-methylidenehepta-3,5-dienyl]carbamate (PubChem CID 166689590) has the molecular formula C15H25NO4S and a molecular weight of 315.44 g/mol. Its IUPAC name is tert-butyl N-[(3Z,5E)-5-ethylsulfonyl-2-methylidenehepta-3,5-dienyl]carbamate.
| Compound Name | tert-butyl N-[(3Z,5E)-5-ethylsulfonyl-2-methylidenehepta-3,5-dienyl]carbamate |
|---|---|
| PubChem CID | 166689590 |
| Molecular Formula | C15H25NO4S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | tert-butyl N-[(3Z,5E)-5-ethylsulfonyl-2-methylidenehepta-3,5-dienyl]carbamate |
| SMILES | C=C(/C=C\C(=C/C)S(=O)(=O)CC)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H25NO4S/c1-7-13(21(18,19)8-2)10-9-12(3)11-16-14(17)20-15(4,5)6/h7,9-10H,3,8,11H2,1-2,4-6H3,(H,16,17)/b10-9-,13-7+ |
| InChIKey | ORRODEIJXFMSGU-QLNUPNCESA-N |
| XLogP | 2.96 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|