C19H36N2O4 — CID 11462443
tert-butyl N-[6-[hydroxy-[(E)-oct-2-enoyl]amino]hexyl]carbamate (PubChem CID 11462443) has the molecular formula C19H36N2O4 and a molecular weight of 356.51 g/mol. Its IUPAC name is tert-butyl N-[6-[hydroxy-[(E)-oct-2-enoyl]amino]hexyl]carbamate.
| Compound Name | tert-butyl N-[6-[hydroxy-[(E)-oct-2-enoyl]amino]hexyl]carbamate |
|---|---|
| PubChem CID | 11462443 |
| Molecular Formula | C19H36N2O4 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | tert-butyl N-[6-[hydroxy-[(E)-oct-2-enoyl]amino]hexyl]carbamate |
| SMILES | CCCCC/C=C/C(=O)N(O)CCCCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H36N2O4/c1-5-6-7-8-11-14-17(22)21(24)16-13-10-9-12-15-20-18(23)25-19(2,3)4/h11,14,24H,5-10,12-13,15-16H2,1-4H3,(H,20,23)/b14-11+ |
| InChIKey | JJDAVGGVFVCBAH-SDNWHVSQSA-N |
| XLogP | 4.43 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|