C16H29F3N2O4 — CID 11749012
(E)-N-(6-aminohexyl)-N-hydroxyoct-2-enamide;2,2,2-trifluoroacetic acid (PubChem CID 11749012) has the molecular formula C16H29F3N2O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is (E)-N-(6-aminohexyl)-N-hydroxyoct-2-enamide;2,2,2-trifluoroacetic acid.
| Compound Name | (E)-N-(6-aminohexyl)-N-hydroxyoct-2-enamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 11749012 |
| Molecular Formula | C16H29F3N2O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | (E)-N-(6-aminohexyl)-N-hydroxyoct-2-enamide;2,2,2-trifluoroacetic acid |
| SMILES | CCCCC/C=C/C(=O)N(O)CCCCCCN.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H28N2O2.C2HF3O2/c1-2-3-4-5-8-11-14(17)16(18)13-10-7-6-9-12-15;3-2(4,5)1(6)7/h8,11,18H,2-7,9-10,12-13,15H2,1H3;(H,6,7)/b11-8+; |
| InChIKey | NFSIEQKFHIGFAY-YGCVIUNWSA-N |
| XLogP | 3.49 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|