C24H45NO4 — CID 142498904
[(Z)-pent-2-enyl] 4-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-nonylamino]butanoate (PubChem CID 142498904) has the molecular formula C24H45NO4 and a molecular weight of 411.63 g/mol. Its IUPAC name is [(Z)-pent-2-enyl] 4-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-nonylamino]butanoate.
| Compound Name | [(Z)-pent-2-enyl] 4-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-nonylamino]butanoate |
|---|---|
| PubChem CID | 142498904 |
| Molecular Formula | C24H45NO4 |
| Molecular Weight | 411.63 g/mol |
| Exact Mass | 411.33 |
| IUPAC Name | [(Z)-pent-2-enyl] 4-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-nonylamino]butanoate |
| SMILES | CC/C=C\COC(=O)CCCN(CCCCCCCCC)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H45NO4/c1-6-8-10-11-12-13-14-18-25(21-23(27)29-24(3,4)5)19-16-17-22(26)28-20-15-9-7-2/h9,15H,6-8,10-14,16-21H2,1-5H3/b15-9- |
| InChIKey | HOYRJUPRYOYIPB-DHDCSXOGSA-N |
| XLogP | 5.67 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.63 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|