C37H69NO5 — CID 170227784
[(Z)-non-2-enyl] 8-[2-methoxyethyl-[8-[(Z)-non-2-enoxy]-8-oxooctyl]amino]octanoate (PubChem CID 170227784) has the molecular formula C37H69NO5 and a molecular weight of 607.96 g/mol. Its IUPAC name is [(Z)-non-2-enyl] 8-[2-methoxyethyl-[8-[(Z)-non-2-enoxy]-8-oxooctyl]amino]octanoate.
| Compound Name | [(Z)-non-2-enyl] 8-[2-methoxyethyl-[8-[(Z)-non-2-enoxy]-8-oxooctyl]amino]octanoate |
|---|---|
| PubChem CID | 170227784 |
| Molecular Formula | C37H69NO5 |
| Molecular Weight | 607.96 g/mol |
| Exact Mass | 607.52 |
| IUPAC Name | [(Z)-non-2-enyl] 8-[2-methoxyethyl-[8-[(Z)-non-2-enoxy]-8-oxooctyl]amino]octanoate |
| SMILES | CCCCCC/C=C\COC(=O)CCCCCCCN(CCCCCCCC(=O)OC/C=C\CCCCCC)CCOC |
| InChI | InChI=1S/C37H69NO5/c1-4-6-8-10-12-20-26-33-42-36(39)28-22-16-14-18-24-30-38(32-35-41-3)31-25-19-15-17-23-29-37(40)43-34-27-21-13-11-9-7-5-2/h20-21,26-27H,4-19,22-25,28-35H2,1-3H3/b26-20-,27-21- |
| InChIKey | QUGPMYRFWIDRJY-AQPNWFMJSA-N |
| XLogP | 9.76 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.96 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|