C39H74N2O4 — CID 155383377
[(E)-non-2-enyl] 9-[3-aminopropyl-[9-[(E)-non-2-enoxy]-9-oxononyl]amino]nonanoate (PubChem CID 155383377) has the molecular formula C39H74N2O4 and a molecular weight of 635.03 g/mol. Its IUPAC name is [(E)-non-2-enyl] 9-[3-aminopropyl-[9-[(E)-non-2-enoxy]-9-oxononyl]amino]nonanoate.
| Compound Name | [(E)-non-2-enyl] 9-[3-aminopropyl-[9-[(E)-non-2-enoxy]-9-oxononyl]amino]nonanoate |
|---|---|
| PubChem CID | 155383377 |
| Molecular Formula | C39H74N2O4 |
| Molecular Weight | 635.03 g/mol |
| Exact Mass | 634.56 |
| IUPAC Name | [(E)-non-2-enyl] 9-[3-aminopropyl-[9-[(E)-non-2-enoxy]-9-oxononyl]amino]nonanoate |
| SMILES | CCCCCC/C=C/COC(=O)CCCCCCCCN(CCCN)CCCCCCCCC(=O)OC/C=C/CCCCCC |
| InChI | InChI=1S/C39H74N2O4/c1-3-5-7-9-15-21-27-36-44-38(42)30-23-17-11-13-19-25-33-41(35-29-32-40)34-26-20-14-12-18-24-31-39(43)45-37-28-22-16-10-8-6-4-2/h21-22,27-28H,3-20,23-26,29-37,40H2,1-2H3/b27-21+,28-22+ |
| InChIKey | WRNMHLWMYXNCLK-GPAWKIAZSA-N |
| XLogP | 10.24 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.03 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|