C9H13F3O3 — CID 77102470
2-ethyl-4-(1,1,1-trifluoropropan-2-yloxy)but-2-enoic acid (PubChem CID 77102470) has the molecular formula C9H13F3O3 and a molecular weight of 226.19 g/mol. Its IUPAC name is 2-ethyl-4-(1,1,1-trifluoropropan-2-yloxy)but-2-enoic acid.
| Compound Name | 2-ethyl-4-(1,1,1-trifluoropropan-2-yloxy)but-2-enoic acid |
|---|---|
| PubChem CID | 77102470 |
| Molecular Formula | C9H13F3O3 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 2-ethyl-4-(1,1,1-trifluoropropan-2-yloxy)but-2-enoic acid |
| SMILES | CCC(=CCOC(C)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C9H13F3O3/c1-3-7(8(13)14)4-5-15-6(2)9(10,11)12/h4,6H,3,5H2,1-2H3,(H,13,14) |
| InChIKey | VYJZJXMLLTZZCB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|