C12H22O4 — CID 106446591
2-ethyl-4-[2-(2-methylpropoxy)ethoxy]but-2-enoic acid (PubChem CID 106446591) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is 2-ethyl-4-[2-(2-methylpropoxy)ethoxy]but-2-enoic acid.
| Compound Name | 2-ethyl-4-[2-(2-methylpropoxy)ethoxy]but-2-enoic acid |
|---|---|
| PubChem CID | 106446591 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 2-ethyl-4-[2-(2-methylpropoxy)ethoxy]but-2-enoic acid |
| SMILES | CCC(=CCOCCOCC(C)C)C(=O)O |
| InChI | InChI=1S/C12H22O4/c1-4-11(12(13)14)5-6-15-7-8-16-9-10(2)3/h5,10H,4,6-9H2,1-3H3,(H,13,14) |
| InChIKey | HHVUIRZUFKVOLB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|