C12H9Cl5O3 — CID 77101240
2-ethyl-4-(2,3,4,5,6-pentachlorophenoxy)but-2-enoic acid (PubChem CID 77101240) has the molecular formula C12H9Cl5O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is 2-ethyl-4-(2,3,4,5,6-pentachlorophenoxy)but-2-enoic acid.
| Compound Name | 2-ethyl-4-(2,3,4,5,6-pentachlorophenoxy)but-2-enoic acid |
|---|---|
| PubChem CID | 77101240 |
| Molecular Formula | C12H9Cl5O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 375.90 |
| IUPAC Name | 2-ethyl-4-(2,3,4,5,6-pentachlorophenoxy)but-2-enoic acid |
| SMILES | CCC(=CCOc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl)C(=O)O |
| InChI | InChI=1S/C12H9Cl5O3/c1-2-5(12(18)19)3-4-20-11-9(16)7(14)6(13)8(15)10(11)17/h3H,2,4H2,1H3,(H,18,19) |
| InChIKey | ULOZHLPVKYBRLW-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|