C13H14Br2O4 — CID 79415643
4-(2,5-dibromo-4-methoxyphenoxy)-2-ethylbut-2-enoic acid (PubChem CID 79415643) has the molecular formula C13H14Br2O4 and a molecular weight of 394.06 g/mol. Its IUPAC name is 4-(2,5-dibromo-4-methoxyphenoxy)-2-ethylbut-2-enoic acid.
| Compound Name | 4-(2,5-dibromo-4-methoxyphenoxy)-2-ethylbut-2-enoic acid |
|---|---|
| PubChem CID | 79415643 |
| Molecular Formula | C13H14Br2O4 |
| Molecular Weight | 394.06 g/mol |
| Exact Mass | 391.93 |
| IUPAC Name | 4-(2,5-dibromo-4-methoxyphenoxy)-2-ethylbut-2-enoic acid |
| SMILES | CCC(=CCOc1cc(Br)c(OC)cc1Br)C(=O)O |
| InChI | InChI=1S/C13H14Br2O4/c1-3-8(13(16)17)4-5-19-12-7-9(14)11(18-2)6-10(12)15/h4,6-7H,3,5H2,1-2H3,(H,16,17) |
| InChIKey | FCDDMKUVZXYMKA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.06 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|