C14H17NO5 — CID 77100700
4-(2,5-dimethyl-4-nitrophenoxy)-2-ethylbut-2-enoic acid (PubChem CID 77100700) has the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. Its IUPAC name is 4-(2,5-dimethyl-4-nitrophenoxy)-2-ethylbut-2-enoic acid.
| Compound Name | 4-(2,5-dimethyl-4-nitrophenoxy)-2-ethylbut-2-enoic acid |
|---|---|
| PubChem CID | 77100700 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 4-(2,5-dimethyl-4-nitrophenoxy)-2-ethylbut-2-enoic acid |
| SMILES | CCC(=CCOc1cc(C)c([N+](=O)[O-])cc1C)C(=O)O |
| InChI | InChI=1S/C14H17NO5/c1-4-11(14(16)17)5-6-20-13-8-9(2)12(15(18)19)7-10(13)3/h5,7-8H,4,6H2,1-3H3,(H,16,17) |
| InChIKey | POEGBEURQLCVFN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|