C13H18N2O5 — CID 63184664
methyl 3-(2,5-dimethyl-4-nitrophenoxy)-2-(methylamino)propanoate (PubChem CID 63184664) has the molecular formula C13H18N2O5 and a molecular weight of 282.30 g/mol. Its IUPAC name is methyl 3-(2,5-dimethyl-4-nitrophenoxy)-2-(methylamino)propanoate.
| Compound Name | methyl 3-(2,5-dimethyl-4-nitrophenoxy)-2-(methylamino)propanoate |
|---|---|
| PubChem CID | 63184664 |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | methyl 3-(2,5-dimethyl-4-nitrophenoxy)-2-(methylamino)propanoate |
| SMILES | CNC(COc1cc(C)c([N+](=O)[O-])cc1C)C(=O)OC |
| InChI | InChI=1S/C13H18N2O5/c1-8-6-12(9(2)5-11(8)15(17)18)20-7-10(14-3)13(16)19-4/h5-6,10,14H,7H2,1-4H3 |
| InChIKey | QXAZHWPGIGOZQT-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|