C14H21NO4 — CID 103867890
6-(2,5-dimethyl-4-nitrophenoxy)hexan-1-ol (PubChem CID 103867890) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is 6-(2,5-dimethyl-4-nitrophenoxy)hexan-1-ol.
| Compound Name | 6-(2,5-dimethyl-4-nitrophenoxy)hexan-1-ol |
|---|---|
| PubChem CID | 103867890 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 6-(2,5-dimethyl-4-nitrophenoxy)hexan-1-ol |
| SMILES | Cc1cc([N+](=O)[O-])c(C)cc1OCCCCCCO |
| InChI | InChI=1S/C14H21NO4/c1-11-10-14(12(2)9-13(11)15(17)18)19-8-6-4-3-5-7-16/h9-10,16H,3-8H2,1-2H3 |
| InChIKey | OISZMIZQOXGJQL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|