C12H16BrNO3 — CID 64995895
1-(3-bromo-2-methylpropoxy)-2,5-dimethyl-4-nitrobenzene (PubChem CID 64995895) has the molecular formula C12H16BrNO3 and a molecular weight of 302.17 g/mol. Its IUPAC name is 1-(3-bromo-2-methylpropoxy)-2,5-dimethyl-4-nitrobenzene.
| Compound Name | 1-(3-bromo-2-methylpropoxy)-2,5-dimethyl-4-nitrobenzene |
|---|---|
| PubChem CID | 64995895 |
| Molecular Formula | C12H16BrNO3 |
| Molecular Weight | 302.17 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 1-(3-bromo-2-methylpropoxy)-2,5-dimethyl-4-nitrobenzene |
| SMILES | Cc1cc([N+](=O)[O-])c(C)cc1OCC(C)CBr |
| InChI | InChI=1S/C12H16BrNO3/c1-8(6-13)7-17-12-5-9(2)11(14(15)16)4-10(12)3/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | UQJYYONUXKBLQZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.17 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|