C13H12BrNO3S — CID 55192236
2-bromo-5-[(2,5-dimethyl-4-nitrophenoxy)methyl]thiophene (PubChem CID 55192236) has the molecular formula C13H12BrNO3S and a molecular weight of 342.21 g/mol. Its IUPAC name is 2-bromo-5-[(2,5-dimethyl-4-nitrophenoxy)methyl]thiophene.
| Compound Name | 2-bromo-5-[(2,5-dimethyl-4-nitrophenoxy)methyl]thiophene |
|---|---|
| PubChem CID | 55192236 |
| Molecular Formula | C13H12BrNO3S |
| Molecular Weight | 342.21 g/mol |
| Exact Mass | 340.97 |
| IUPAC Name | 2-bromo-5-[(2,5-dimethyl-4-nitrophenoxy)methyl]thiophene |
| SMILES | Cc1cc([N+](=O)[O-])c(C)cc1OCc1ccc(Br)s1 |
| InChI | InChI=1S/C13H12BrNO3S/c1-8-6-12(9(2)5-11(8)15(16)17)18-7-10-3-4-13(14)19-10/h3-6H,7H2,1-2H3 |
| InChIKey | CBAWCPVRGFTWBF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.21 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|