C14H13NO5S — CID 63640875
3-[(2,5-dimethyl-4-nitrophenoxy)methyl]thiophene-2-carboxylic acid (PubChem CID 63640875) has the molecular formula C14H13NO5S and a molecular weight of 307.33 g/mol. Its IUPAC name is 3-[(2,5-dimethyl-4-nitrophenoxy)methyl]thiophene-2-carboxylic acid.
| Compound Name | 3-[(2,5-dimethyl-4-nitrophenoxy)methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 63640875 |
| Molecular Formula | C14H13NO5S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 3-[(2,5-dimethyl-4-nitrophenoxy)methyl]thiophene-2-carboxylic acid |
| SMILES | Cc1cc([N+](=O)[O-])c(C)cc1OCc1ccsc1C(=O)O |
| InChI | InChI=1S/C14H13NO5S/c1-8-6-12(9(2)5-11(8)15(18)19)20-7-10-3-4-21-13(10)14(16)17/h3-6H,7H2,1-2H3,(H,16,17) |
| InChIKey | RXWQYZGADNKGAK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|