C14H13ClN2O3 — CID 79243325
2-chloro-6-[(2,5-dimethyl-4-nitrophenoxy)methyl]pyridine (PubChem CID 79243325) has the molecular formula C14H13ClN2O3 and a molecular weight of 292.72 g/mol. Its IUPAC name is 2-chloro-6-[(2,5-dimethyl-4-nitrophenoxy)methyl]pyridine.
| Compound Name | 2-chloro-6-[(2,5-dimethyl-4-nitrophenoxy)methyl]pyridine |
|---|---|
| PubChem CID | 79243325 |
| Molecular Formula | C14H13ClN2O3 |
| Molecular Weight | 292.72 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 2-chloro-6-[(2,5-dimethyl-4-nitrophenoxy)methyl]pyridine |
| SMILES | Cc1cc([N+](=O)[O-])c(C)cc1OCc1cccc(Cl)n1 |
| InChI | InChI=1S/C14H13ClN2O3/c1-9-7-13(10(2)6-12(9)17(18)19)20-8-11-4-3-5-14(15)16-11/h3-7H,8H2,1-2H3 |
| InChIKey | OACBVFBTYYTSRY-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.72 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|