C18H15NO3 — CID 66594066
1-(2,5-dimethyl-4-nitrophenoxy)naphthalene (PubChem CID 66594066) has the molecular formula C18H15NO3 and a molecular weight of 293.32 g/mol. Its IUPAC name is 1-(2,5-dimethyl-4-nitrophenoxy)naphthalene.
| Compound Name | 1-(2,5-dimethyl-4-nitrophenoxy)naphthalene |
|---|---|
| PubChem CID | 66594066 |
| Molecular Formula | C18H15NO3 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 1-(2,5-dimethyl-4-nitrophenoxy)naphthalene |
| SMILES | Cc1cc([N+](=O)[O-])c(C)cc1Oc1cccc2ccccc12 |
| InChI | InChI=1S/C18H15NO3/c1-12-11-18(13(2)10-16(12)19(20)21)22-17-9-5-7-14-6-3-4-8-15(14)17/h3-11H,1-2H3 |
| InChIKey | FTZLRVQYNLFRRC-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|