C15H13BrClNO3 — CID 107088451
1-[2-(bromomethyl)-3-chlorophenoxy]-2,5-dimethyl-4-nitrobenzene (PubChem CID 107088451) has the molecular formula C15H13BrClNO3 and a molecular weight of 370.63 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-3-chlorophenoxy]-2,5-dimethyl-4-nitrobenzene.
| Compound Name | 1-[2-(bromomethyl)-3-chlorophenoxy]-2,5-dimethyl-4-nitrobenzene |
|---|---|
| PubChem CID | 107088451 |
| Molecular Formula | C15H13BrClNO3 |
| Molecular Weight | 370.63 g/mol |
| Exact Mass | 368.98 |
| IUPAC Name | 1-[2-(bromomethyl)-3-chlorophenoxy]-2,5-dimethyl-4-nitrobenzene |
| SMILES | Cc1cc([N+](=O)[O-])c(C)cc1Oc1cccc(Cl)c1CBr |
| InChI | InChI=1S/C15H13BrClNO3/c1-9-7-15(10(2)6-13(9)18(19)20)21-14-5-3-4-12(17)11(14)8-16/h3-7H,8H2,1-2H3 |
| InChIKey | FSBICKIFPAJZQW-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.63 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|