C26H19Cl5N2O6 — CID 159310224
1-chloro-2-(2-chlorophenoxy)-4-methyl-5-nitrobenzene;2-chlorophenol;1,2-dichloro-4-methyl-5-nitrobenzene (PubChem CID 159310224) has the molecular formula C26H19Cl5N2O6 and a molecular weight of 632.71 g/mol. Its IUPAC name is 1-chloro-2-(2-chlorophenoxy)-4-methyl-5-nitrobenzene;2-chlorophenol;1,2-dichloro-4-methyl-5-nitrobenzene.
| Compound Name | 1-chloro-2-(2-chlorophenoxy)-4-methyl-5-nitrobenzene;2-chlorophenol;1,2-dichloro-4-methyl-5-nitrobenzene |
|---|---|
| PubChem CID | 159310224 |
| Molecular Formula | C26H19Cl5N2O6 |
| Molecular Weight | 632.71 g/mol |
| Exact Mass | 629.97 |
| IUPAC Name | 1-chloro-2-(2-chlorophenoxy)-4-methyl-5-nitrobenzene;2-chlorophenol;1,2-dichloro-4-methyl-5-nitrobenzene |
| SMILES | Cc1cc(Cl)c(Cl)cc1[N+](=O)[O-].Cc1cc(Oc2ccccc2Cl)c(Cl)cc1[N+](=O)[O-].Oc1ccccc1Cl |
| InChI | InChI=1S/C13H9Cl2NO3.C7H5Cl2NO2.C6H5ClO/c1-8-6-13(10(15)7-11(8)16(17)18)19-12-5-3-2-4-9(12)14;1-4-2-5(8)6(9)3-7(4)10(11)12;7-5-3-1-2-4-6(5)8/h2-7H,1H3;2-3H,1H3;1-4,8H |
| InChIKey | LCLBLQKKDXOQAA-UHFFFAOYSA-N |
| XLogP | 10.26 |
| TPSA | 115.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.71 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|