C18H21NO3 — CID 23434361
1-(3-tert-butylphenoxy)-2,5-dimethyl-4-nitrobenzene (PubChem CID 23434361) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is 1-(3-tert-butylphenoxy)-2,5-dimethyl-4-nitrobenzene.
| Compound Name | 1-(3-tert-butylphenoxy)-2,5-dimethyl-4-nitrobenzene |
|---|---|
| PubChem CID | 23434361 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 1-(3-tert-butylphenoxy)-2,5-dimethyl-4-nitrobenzene |
| SMILES | Cc1cc([N+](=O)[O-])c(C)cc1Oc1cccc(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H21NO3/c1-12-10-17(13(2)9-16(12)19(20)21)22-15-8-6-7-14(11-15)18(3,4)5/h6-11H,1-5H3 |
| InChIKey | IPIKUMFVECAFKT-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|