About sodium (3-tert-butylphenyl) (4-nitrophenyl) phosphate
sodium (3-tert-butylphenyl) (4-nitrophenyl) phosphate (PubChem CID 14886425) has the molecular formula C16H17NNaO6P
and a molecular weight of 373.28 g/mol. Its IUPAC name is sodium (3-tert-butylphenyl) (4-nitrophenyl) phosphate.
Molecular Properties
| Compound Name | sodium (3-tert-butylphenyl) (4-nitrophenyl) phosphate |
| PubChem CID | 14886425 |
| Molecular Formula | C16H17NNaO6P |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | sodium (3-tert-butylphenyl) (4-nitrophenyl) phosphate |
| SMILES | CC(C)(C)c1cccc(OP(=O)([O-])Oc2ccc([N+](=O)[O-])cc2)c1.[Na+] |
| InChI | InChI=1S/C16H18NO6P.Na/c1-16(2,3)12-5-4-6-15(11-12)23-24(20,21)22-14-9-7-13(8-10-14)17(18)19;/h4-11H,1-3H3,(H,20,21);/q;+1/p-1 |
| InChIKey | JQZGBKRUZWFJAY-UHFFFAOYSA-M |
| XLogP | 0.82 |
| TPSA | 101.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium (3-tert-butylphenyl) (4-nitrophenyl) phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium (3-tert-butylphenyl) (4-nitrophenyl) phosphate?
The IUPAC name of sodium (3-tert-butylphenyl) (4-nitrophenyl) phosphate (CID 14886425) is sodium (3-tert-butylphenyl) (4-nitrophenyl) phosphate.
What is the SMILES notation for sodium (3-tert-butylphenyl) (4-nitrophenyl) phosphate?
The canonical SMILES for sodium (3-tert-butylphenyl) (4-nitrophenyl) phosphate is CC(C)(C)c1cccc(OP(=O)([O-])Oc2ccc([N+](=O)[O-])cc2)c1.[Na+].
What is the InChIKey of sodium (3-tert-butylphenyl) (4-nitrophenyl) phosphate?
The InChIKey is JQZGBKRUZWFJAY-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H18NO6P.Na/c1-16(2,3)12-5-4-6-15(11-12)23-24(20,21)22-14-9-7-13(8-10-14)17(18)19;/h4-11H,1-3H3,(H,20,21);/q;+1/p-1.
What are the key properties of sodium (3-tert-butylphenyl) (4-nitrophenyl) phosphate?
sodium (3-tert-butylphenyl) (4-nitrophenyl) phosphate has a molecular weight of 373.28 g/mol, XLogP of 0.82, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium (3-tert-butylphenyl) (4-nitrophenyl) phosphate is sourced from PubChem (CID 14886425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).