C14H20BrNO3 — CID 65011716
1-[2-(bromomethyl)-3-methylbutoxy]-2,5-dimethyl-4-nitrobenzene (PubChem CID 65011716) has the molecular formula C14H20BrNO3 and a molecular weight of 330.22 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-3-methylbutoxy]-2,5-dimethyl-4-nitrobenzene.
| Compound Name | 1-[2-(bromomethyl)-3-methylbutoxy]-2,5-dimethyl-4-nitrobenzene |
|---|---|
| PubChem CID | 65011716 |
| Molecular Formula | C14H20BrNO3 |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 1-[2-(bromomethyl)-3-methylbutoxy]-2,5-dimethyl-4-nitrobenzene |
| SMILES | Cc1cc([N+](=O)[O-])c(C)cc1OCC(CBr)C(C)C |
| InChI | InChI=1S/C14H20BrNO3/c1-9(2)12(7-15)8-19-14-6-10(3)13(16(17)18)5-11(14)4/h5-6,9,12H,7-8H2,1-4H3 |
| InChIKey | PAIMCFDZEGDYIA-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|