C12H16N2O8 — CID 19604125
3-[2-(3-hydroxypropoxy)-4,5-dinitrophenoxy]propan-1-ol (PubChem CID 19604125) has the molecular formula C12H16N2O8 and a molecular weight of 316.27 g/mol. Its IUPAC name is 3-[2-(3-hydroxypropoxy)-4,5-dinitrophenoxy]propan-1-ol.
| Compound Name | 3-[2-(3-hydroxypropoxy)-4,5-dinitrophenoxy]propan-1-ol |
|---|---|
| PubChem CID | 19604125 |
| Molecular Formula | C12H16N2O8 |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 3-[2-(3-hydroxypropoxy)-4,5-dinitrophenoxy]propan-1-ol |
| SMILES | O=[N+]([O-])c1cc(OCCCO)c(OCCCO)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H16N2O8/c15-3-1-5-21-11-7-9(13(17)18)10(14(19)20)8-12(11)22-6-2-4-16/h7-8,15-16H,1-6H2 |
| InChIKey | DCEKBPSMTUGJAW-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 145.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|