C9H9F2NO4 — CID 63597608
3-(2,5-difluoro-4-nitrophenoxy)propan-1-ol (PubChem CID 63597608) has the molecular formula C9H9F2NO4 and a molecular weight of 233.17 g/mol. Its IUPAC name is 3-(2,5-difluoro-4-nitrophenoxy)propan-1-ol.
| Compound Name | 3-(2,5-difluoro-4-nitrophenoxy)propan-1-ol |
|---|---|
| PubChem CID | 63597608 |
| Molecular Formula | C9H9F2NO4 |
| Molecular Weight | 233.17 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 3-(2,5-difluoro-4-nitrophenoxy)propan-1-ol |
| SMILES | O=[N+]([O-])c1cc(F)c(OCCCO)cc1F |
| InChI | InChI=1S/C9H9F2NO4/c10-6-5-9(16-3-1-2-13)7(11)4-8(6)12(14)15/h4-5,13H,1-3H2 |
| InChIKey | WQOUUOUOGMPUTB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.17 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|