C10H7F2NO3 — CID 63655228
1-but-3-ynoxy-2,5-difluoro-4-nitrobenzene (PubChem CID 63655228) has the molecular formula C10H7F2NO3 and a molecular weight of 227.17 g/mol. Its IUPAC name is 1-but-3-ynoxy-2,5-difluoro-4-nitrobenzene.
| Compound Name | 1-but-3-ynoxy-2,5-difluoro-4-nitrobenzene |
|---|---|
| PubChem CID | 63655228 |
| Molecular Formula | C10H7F2NO3 |
| Molecular Weight | 227.17 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 1-but-3-ynoxy-2,5-difluoro-4-nitrobenzene |
| SMILES | C#CCCOc1cc(F)c([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C10H7F2NO3/c1-2-3-4-16-10-6-7(11)9(13(14)15)5-8(10)12/h1,5-6H,3-4H2 |
| InChIKey | FUKZJLLESXXBDY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.17 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|