C12H15F2N3O3 — CID 63597783
1-[2-(2,5-difluoro-4-nitrophenoxy)ethyl]piperazine (PubChem CID 63597783) has the molecular formula C12H15F2N3O3 and a molecular weight of 287.27 g/mol. Its IUPAC name is 1-[2-(2,5-difluoro-4-nitrophenoxy)ethyl]piperazine.
| Compound Name | 1-[2-(2,5-difluoro-4-nitrophenoxy)ethyl]piperazine |
|---|---|
| PubChem CID | 63597783 |
| Molecular Formula | C12H15F2N3O3 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 1-[2-(2,5-difluoro-4-nitrophenoxy)ethyl]piperazine |
| SMILES | O=[N+]([O-])c1cc(F)c(OCCN2CCNCC2)cc1F |
| InChI | InChI=1S/C12H15F2N3O3/c13-9-8-12(10(14)7-11(9)17(18)19)20-6-5-16-3-1-15-2-4-16/h7-8,15H,1-6H2 |
| InChIKey | VKGHYKCVGAKCAM-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|