C9H8ClF2NO3 — CID 63599005
1-(3-chloropropoxy)-2,5-difluoro-4-nitrobenzene (PubChem CID 63599005) has the molecular formula C9H8ClF2NO3 and a molecular weight of 251.62 g/mol. Its IUPAC name is 1-(3-chloropropoxy)-2,5-difluoro-4-nitrobenzene.
| Compound Name | 1-(3-chloropropoxy)-2,5-difluoro-4-nitrobenzene |
|---|---|
| PubChem CID | 63599005 |
| Molecular Formula | C9H8ClF2NO3 |
| Molecular Weight | 251.62 g/mol |
| Exact Mass | 251.02 |
| IUPAC Name | 1-(3-chloropropoxy)-2,5-difluoro-4-nitrobenzene |
| SMILES | O=[N+]([O-])c1cc(F)c(OCCCCl)cc1F |
| InChI | InChI=1S/C9H8ClF2NO3/c10-2-1-3-16-9-5-6(11)8(13(14)15)4-7(9)12/h4-5H,1-3H2 |
| InChIKey | AWDWHMOPOFFQBY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.62 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|