C13H17F2N3O3 — CID 65258662
5-(2,5-difluoro-4-nitrophenoxy)-2,2-dimethylpentanimidamide (PubChem CID 65258662) has the molecular formula C13H17F2N3O3 and a molecular weight of 301.29 g/mol. Its IUPAC name is 5-(2,5-difluoro-4-nitrophenoxy)-2,2-dimethylpentanimidamide.
| Compound Name | 5-(2,5-difluoro-4-nitrophenoxy)-2,2-dimethylpentanimidamide |
|---|---|
| PubChem CID | 65258662 |
| Molecular Formula | C13H17F2N3O3 |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 5-(2,5-difluoro-4-nitrophenoxy)-2,2-dimethylpentanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCCOc1cc(F)c([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C13H17F2N3O3/c1-13(2,12(16)17)4-3-5-21-11-7-8(14)10(18(19)20)6-9(11)15/h6-7H,3-5H2,1-2H3,(H3,16,17) |
| InChIKey | ZDYAVHZMTLPVDF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|