C10H8F5N3O3 — CID 103371050
2-[(2,5-difluoro-4-nitrophenoxy)methyl]-3,3,3-trifluoropropanimidamide (PubChem CID 103371050) has the molecular formula C10H8F5N3O3 and a molecular weight of 313.18 g/mol. Its IUPAC name is 2-[(2,5-difluoro-4-nitrophenoxy)methyl]-3,3,3-trifluoropropanimidamide.
| Compound Name | 2-[(2,5-difluoro-4-nitrophenoxy)methyl]-3,3,3-trifluoropropanimidamide |
|---|---|
| PubChem CID | 103371050 |
| Molecular Formula | C10H8F5N3O3 |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 2-[(2,5-difluoro-4-nitrophenoxy)methyl]-3,3,3-trifluoropropanimidamide |
| SMILES | [H]/N=C(\N)C(COc1cc(F)c([N+](=O)[O-])cc1F)C(F)(F)F |
| InChI | InChI=1S/C10H8F5N3O3/c11-5-2-8(6(12)1-7(5)18(19)20)21-3-4(9(16)17)10(13,14)15/h1-2,4H,3H2,(H3,16,17) |
| InChIKey | LUUFNEWXMIDQKB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|