C10H9F4N3O3 — CID 103371013
3,3,3-trifluoro-2-[(5-fluoro-2-nitrophenoxy)methyl]propanimidamide (PubChem CID 103371013) has the molecular formula C10H9F4N3O3 and a molecular weight of 295.19 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[(5-fluoro-2-nitrophenoxy)methyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-2-[(5-fluoro-2-nitrophenoxy)methyl]propanimidamide |
|---|---|
| PubChem CID | 103371013 |
| Molecular Formula | C10H9F4N3O3 |
| Molecular Weight | 295.19 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 3,3,3-trifluoro-2-[(5-fluoro-2-nitrophenoxy)methyl]propanimidamide |
| SMILES | [H]/N=C(\N)C(COc1cc(F)ccc1[N+](=O)[O-])C(F)(F)F |
| InChI | InChI=1S/C10H9F4N3O3/c11-5-1-2-7(17(18)19)8(3-5)20-4-6(9(15)16)10(12,13)14/h1-3,6H,4H2,(H3,15,16) |
| InChIKey | JVNDUWIXDUPKDI-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.19 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|