C9H4F7NO3 — CID 14453328
4-fluoro-2-(1,1,2,3,3,3-hexafluoropropoxy)-1-nitrobenzene (PubChem CID 14453328) has the molecular formula C9H4F7NO3 and a molecular weight of 307.12 g/mol. Its IUPAC name is 4-fluoro-2-(1,1,2,3,3,3-hexafluoropropoxy)-1-nitrobenzene.
| Compound Name | 4-fluoro-2-(1,1,2,3,3,3-hexafluoropropoxy)-1-nitrobenzene |
|---|---|
| PubChem CID | 14453328 |
| Molecular Formula | C9H4F7NO3 |
| Molecular Weight | 307.12 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | 4-fluoro-2-(1,1,2,3,3,3-hexafluoropropoxy)-1-nitrobenzene |
| SMILES | O=[N+]([O-])c1ccc(F)cc1OC(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C9H4F7NO3/c10-4-1-2-5(17(18)19)6(3-4)20-9(15,16)7(11)8(12,13)14/h1-3,7H |
| InChIKey | DLEMFAPBJJUNGZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.12 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|