C12H13F2N3O4 — CID 63599204
2-(cyclopropylamino)-3-(2,5-difluoro-4-nitrophenoxy)propanamide (PubChem CID 63599204) has the molecular formula C12H13F2N3O4 and a molecular weight of 301.25 g/mol. Its IUPAC name is 2-(cyclopropylamino)-3-(2,5-difluoro-4-nitrophenoxy)propanamide.
| Compound Name | 2-(cyclopropylamino)-3-(2,5-difluoro-4-nitrophenoxy)propanamide |
|---|---|
| PubChem CID | 63599204 |
| Molecular Formula | C12H13F2N3O4 |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 2-(cyclopropylamino)-3-(2,5-difluoro-4-nitrophenoxy)propanamide |
| SMILES | NC(=O)C(COc1cc(F)c([N+](=O)[O-])cc1F)NC1CC1 |
| InChI | InChI=1S/C12H13F2N3O4/c13-7-4-11(8(14)3-10(7)17(19)20)21-5-9(12(15)18)16-6-1-2-6/h3-4,6,9,16H,1-2,5H2,(H2,15,18) |
| InChIKey | ZXEYQCSJLXVAOJ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|