C12H12BrFN2O5 — CID 103484038
3-(4-bromo-5-fluoro-2-nitrophenoxy)-2-(cyclopropylamino)propanoic acid (PubChem CID 103484038) has the molecular formula C12H12BrFN2O5 and a molecular weight of 363.14 g/mol. Its IUPAC name is 3-(4-bromo-5-fluoro-2-nitrophenoxy)-2-(cyclopropylamino)propanoic acid.
| Compound Name | 3-(4-bromo-5-fluoro-2-nitrophenoxy)-2-(cyclopropylamino)propanoic acid |
|---|---|
| PubChem CID | 103484038 |
| Molecular Formula | C12H12BrFN2O5 |
| Molecular Weight | 363.14 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | 3-(4-bromo-5-fluoro-2-nitrophenoxy)-2-(cyclopropylamino)propanoic acid |
| SMILES | O=C(O)C(COc1cc(F)c(Br)cc1[N+](=O)[O-])NC1CC1 |
| InChI | InChI=1S/C12H12BrFN2O5/c13-7-3-10(16(19)20)11(4-8(7)14)21-5-9(12(17)18)15-6-1-2-6/h3-4,6,9,15H,1-2,5H2,(H,17,18) |
| InChIKey | MLEZZNYWYOEXDZ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.14 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|