C13H17BrFNO3S — CID 103484405
2-[(4-bromo-5-fluoro-2-nitrophenoxy)methyl]-3,3-dimethylbutane-1-thiol (PubChem CID 103484405) has the molecular formula C13H17BrFNO3S and a molecular weight of 366.25 g/mol. Its IUPAC name is 2-[(4-bromo-5-fluoro-2-nitrophenoxy)methyl]-3,3-dimethylbutane-1-thiol.
| Compound Name | 2-[(4-bromo-5-fluoro-2-nitrophenoxy)methyl]-3,3-dimethylbutane-1-thiol |
|---|---|
| PubChem CID | 103484405 |
| Molecular Formula | C13H17BrFNO3S |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | 2-[(4-bromo-5-fluoro-2-nitrophenoxy)methyl]-3,3-dimethylbutane-1-thiol |
| SMILES | CC(C)(C)C(CS)COc1cc(F)c(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H17BrFNO3S/c1-13(2,3)8(7-20)6-19-12-5-10(15)9(14)4-11(12)16(17)18/h4-5,8,20H,6-7H2,1-3H3 |
| InChIKey | QWNLOHIKESKTDY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 52.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|