C11H12BrClFNO5S — CID 103484184
3-(4-bromo-5-fluoro-2-nitrophenoxy)-2,2-dimethylpropane-1-sulfonyl chloride (PubChem CID 103484184) has the molecular formula C11H12BrClFNO5S and a molecular weight of 404.64 g/mol. Its IUPAC name is 3-(4-bromo-5-fluoro-2-nitrophenoxy)-2,2-dimethylpropane-1-sulfonyl chloride.
| Compound Name | 3-(4-bromo-5-fluoro-2-nitrophenoxy)-2,2-dimethylpropane-1-sulfonyl chloride |
|---|---|
| PubChem CID | 103484184 |
| Molecular Formula | C11H12BrClFNO5S |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 402.93 |
| IUPAC Name | 3-(4-bromo-5-fluoro-2-nitrophenoxy)-2,2-dimethylpropane-1-sulfonyl chloride |
| SMILES | CC(C)(COc1cc(F)c(Br)cc1[N+](=O)[O-])CS(=O)(=O)Cl |
| InChI | InChI=1S/C11H12BrClFNO5S/c1-11(2,6-21(13,18)19)5-20-10-4-8(14)7(12)3-9(10)15(16)17/h3-4H,5-6H2,1-2H3 |
| InChIKey | FVUONMWYXYEAFZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|