C12H15ClFNO5S — CID 114418194
3-(2-fluoro-5-methyl-4-nitrophenoxy)-2,2-dimethylpropane-1-sulfonyl chloride (PubChem CID 114418194) has the molecular formula C12H15ClFNO5S and a molecular weight of 339.77 g/mol. Its IUPAC name is 3-(2-fluoro-5-methyl-4-nitrophenoxy)-2,2-dimethylpropane-1-sulfonyl chloride.
| Compound Name | 3-(2-fluoro-5-methyl-4-nitrophenoxy)-2,2-dimethylpropane-1-sulfonyl chloride |
|---|---|
| PubChem CID | 114418194 |
| Molecular Formula | C12H15ClFNO5S |
| Molecular Weight | 339.77 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 3-(2-fluoro-5-methyl-4-nitrophenoxy)-2,2-dimethylpropane-1-sulfonyl chloride |
| SMILES | Cc1cc(OCC(C)(C)CS(=O)(=O)Cl)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H15ClFNO5S/c1-8-4-11(9(14)5-10(8)15(16)17)20-6-12(2,3)7-21(13,18)19/h4-5H,6-7H2,1-3H3 |
| InChIKey | NLLCPVDVPAVPDO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.77 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|