C13H15F2NO4 — CID 65213354
1-[(2,5-difluoro-4-nitrophenoxy)methyl]cyclohexan-1-ol (PubChem CID 65213354) has the molecular formula C13H15F2NO4 and a molecular weight of 287.26 g/mol. Its IUPAC name is 1-[(2,5-difluoro-4-nitrophenoxy)methyl]cyclohexan-1-ol.
| Compound Name | 1-[(2,5-difluoro-4-nitrophenoxy)methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 65213354 |
| Molecular Formula | C13H15F2NO4 |
| Molecular Weight | 287.26 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 1-[(2,5-difluoro-4-nitrophenoxy)methyl]cyclohexan-1-ol |
| SMILES | O=[N+]([O-])c1cc(F)c(OCC2(O)CCCCC2)cc1F |
| InChI | InChI=1S/C13H15F2NO4/c14-9-7-12(10(15)6-11(9)16(18)19)20-8-13(17)4-2-1-3-5-13/h6-7,17H,1-5,8H2 |
| InChIKey | DOFMYDPJTNLUHJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.26 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|