C13H14Br2O4 — CID 79416396
methyl 4-(2,5-dibromo-4-methoxyphenoxy)-2-methylbut-2-enoate (PubChem CID 79416396) has the molecular formula C13H14Br2O4 and a molecular weight of 394.06 g/mol. Its IUPAC name is methyl 4-(2,5-dibromo-4-methoxyphenoxy)-2-methylbut-2-enoate.
| Compound Name | methyl 4-(2,5-dibromo-4-methoxyphenoxy)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 79416396 |
| Molecular Formula | C13H14Br2O4 |
| Molecular Weight | 394.06 g/mol |
| Exact Mass | 391.93 |
| IUPAC Name | methyl 4-(2,5-dibromo-4-methoxyphenoxy)-2-methylbut-2-enoate |
| SMILES | COC(=O)C(C)=CCOc1cc(Br)c(OC)cc1Br |
| InChI | InChI=1S/C13H14Br2O4/c1-8(13(16)18-3)4-5-19-12-7-9(14)11(17-2)6-10(12)15/h4,6-7H,5H2,1-3H3 |
| InChIKey | DHPLRYYCCTXEFZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.06 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|