methyl (E)-4-(4-methoxy-3-nitrophenoxy)-2-methylbut-2-enoate

C13H15NO6 — CID 103201508

IUPACmethyl (E)-4-(4-methoxy-3-nitrophenoxy)-2-methylbut-2-enoate
SMILESCOC(=O)/C(C)=C/COc1ccc(OC)c([N+](=O)[O-])c1
InChIInChI=1S/C13H15NO6/c1-9(13(15)19-3)6-7-20-10-4-5-12(18-2)11(8-10)14(16)17/h4-6,8H,7H2,1-3H3/b9-6+
InChIKeyICQICFGTUNNPCF-RMKNXTFCSA-N
MW281.26 g/mol
LogP2.10
Rot. Bonds6

About methyl (E)-4-(4-methoxy-3-nitrophenoxy)-2-methylbut-2-enoate

methyl (E)-4-(4-methoxy-3-nitrophenoxy)-2-methylbut-2-enoate (PubChem CID 103201508) has the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. Its IUPAC name is methyl (E)-4-(4-methoxy-3-nitrophenoxy)-2-methylbut-2-enoate.

Molecular Properties

Compound Namemethyl (E)-4-(4-methoxy-3-nitrophenoxy)-2-methylbut-2-enoate
PubChem CID103201508
Molecular FormulaC13H15NO6
Molecular Weight281.26 g/mol
Exact Mass281.09
IUPAC Namemethyl (E)-4-(4-methoxy-3-nitrophenoxy)-2-methylbut-2-enoate
SMILESCOC(=O)/C(C)=C/COc1ccc(OC)c([N+](=O)[O-])c1
InChIInChI=1S/C13H15NO6/c1-9(13(15)19-3)6-7-20-10-4-5-12(18-2)11(8-10)14(16)17/h4-6,8H,7H2,1-3H3/b9-6+
InChIKeyICQICFGTUNNPCF-RMKNXTFCSA-N
XLogP2.10
TPSA87.90 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.26
LogP ≤ 52.10
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze methyl (E)-4-(4-methoxy-3-nitrophenoxy)-2-methylbut-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (E)-4-(4-methoxy-3-nitrophenoxy)-2-methylbut-2-enoate?
The IUPAC name of methyl (E)-4-(4-methoxy-3-nitrophenoxy)-2-methylbut-2-enoate (CID 103201508) is methyl (E)-4-(4-methoxy-3-nitrophenoxy)-2-methylbut-2-enoate.
What is the SMILES notation for methyl (E)-4-(4-methoxy-3-nitrophenoxy)-2-methylbut-2-enoate?
The canonical SMILES for methyl (E)-4-(4-methoxy-3-nitrophenoxy)-2-methylbut-2-enoate is COC(=O)/C(C)=C/COc1ccc(OC)c([N+](=O)[O-])c1.
What is the InChIKey of methyl (E)-4-(4-methoxy-3-nitrophenoxy)-2-methylbut-2-enoate?
The InChIKey is ICQICFGTUNNPCF-RMKNXTFCSA-N. The full InChI is InChI=1S/C13H15NO6/c1-9(13(15)19-3)6-7-20-10-4-5-12(18-2)11(8-10)14(16)17/h4-6,8H,7H2,1-3H3/b9-6+.
What are the key properties of methyl (E)-4-(4-methoxy-3-nitrophenoxy)-2-methylbut-2-enoate?
methyl (E)-4-(4-methoxy-3-nitrophenoxy)-2-methylbut-2-enoate has a molecular weight of 281.26 g/mol, XLogP of 2.10, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-4-(4-methoxy-3-nitrophenoxy)-2-methylbut-2-enoate is sourced from PubChem (CID 103201508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).