C10H13N3O5 — CID 103201521
2-amino-3-(4-methoxy-3-nitrophenoxy)propanamide (PubChem CID 103201521) has the molecular formula C10H13N3O5 and a molecular weight of 255.23 g/mol. Its IUPAC name is 2-amino-3-(4-methoxy-3-nitrophenoxy)propanamide.
| Compound Name | 2-amino-3-(4-methoxy-3-nitrophenoxy)propanamide |
|---|---|
| PubChem CID | 103201521 |
| Molecular Formula | C10H13N3O5 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 2-amino-3-(4-methoxy-3-nitrophenoxy)propanamide |
| SMILES | COc1ccc(OCC(N)C(N)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H13N3O5/c1-17-9-3-2-6(4-8(9)13(15)16)18-5-7(11)10(12)14/h2-4,7H,5,11H2,1H3,(H2,12,14) |
| InChIKey | PQKCXYKZSWZXJC-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 130.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|